C14H17N2OP — CID 176995140
N-[(3-methoxyphenyl)methyl]-1-phosphanyl-1-pyridin-3-ylmethanamine (PubChem CID 176995140) has the molecular formula C14H17N2OP and a molecular weight of 260.28 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-1-phosphanyl-1-pyridin-3-ylmethanamine.
| Compound Name | N-[(3-methoxyphenyl)methyl]-1-phosphanyl-1-pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 176995140 |
| Molecular Formula | C14H17N2OP |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-1-phosphanyl-1-pyridin-3-ylmethanamine |
| SMILES | COc1cccc(CNC(P)c2cccnc2)c1 |
| InChI | InChI=1S/C14H17N2OP/c1-17-13-6-2-4-11(8-13)9-16-14(18)12-5-3-7-15-10-12/h2-8,10,14,16H,9,18H2,1H3 |
| InChIKey | LFXQTLLYAWJUNM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|