C17H28N2O2 — CID 79145243
N-[1-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylpiperidin-4-amine (PubChem CID 79145243) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylpiperidin-4-amine.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 79145243 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylpiperidin-4-amine |
| SMILES | COc1ccc(C(C)NC2CCN(C)C(C)C2)cc1OC |
| InChI | InChI=1S/C17H28N2O2/c1-12-10-15(8-9-19(12)3)18-13(2)14-6-7-16(20-4)17(11-14)21-5/h6-7,11-13,15,18H,8-10H2,1-5H3 |
| InChIKey | BYQXCVMZNODCOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |