C17H27NO2 — CID 43317684
N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylcyclohexan-1-amine (PubChem CID 43317684) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43317684 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-methylcyclohexan-1-amine |
| SMILES | COc1ccc(C(C)NC2CCCC(C)C2)cc1OC |
| InChI | InChI=1S/C17H27NO2/c1-12-6-5-7-15(10-12)18-13(2)14-8-9-16(19-3)17(11-14)20-4/h8-9,11-13,15,18H,5-7,10H2,1-4H3 |
| InChIKey | UNHKPXARIUHMMM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |