C16H24N2O3 — CID 63905225
4-[1-(3,4-dimethoxyphenyl)ethylamino]azepan-2-one (PubChem CID 63905225) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[1-(3,4-dimethoxyphenyl)ethylamino]azepan-2-one.
| Compound Name | 4-[1-(3,4-dimethoxyphenyl)ethylamino]azepan-2-one |
|---|---|
| PubChem CID | 63905225 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[1-(3,4-dimethoxyphenyl)ethylamino]azepan-2-one |
| SMILES | COc1ccc(C(C)NC2CCCNC(=O)C2)cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-11(18-13-5-4-8-17-16(19)10-13)12-6-7-14(20-2)15(9-12)21-3/h6-7,9,11,13,18H,4-5,8,10H2,1-3H3,(H,17,19) |
| InChIKey | HPTVEWTZFMAVSO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |