C15H22IN — CID 43775452
N-[1-(4-iodophenyl)ethyl]-3-methylcyclohexan-1-amine (PubChem CID 43775452) has the molecular formula C15H22IN and a molecular weight of 343.25 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)ethyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[1-(4-iodophenyl)ethyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43775452 |
| Molecular Formula | C15H22IN |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[1-(4-iodophenyl)ethyl]-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(NC(C)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C15H22IN/c1-11-4-3-5-15(10-11)17-12(2)13-6-8-14(16)9-7-13/h6-9,11-12,15,17H,3-5,10H2,1-2H3 |
| InChIKey | YYXUXRMNGVZJIZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|