C18H28IN — CID 43784375
N-[1-(4-iodophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine (PubChem CID 43784375) has the molecular formula C18H28IN and a molecular weight of 385.33 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine.
| Compound Name | N-[1-(4-iodophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43784375 |
| Molecular Formula | C18H28IN |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[1-(4-iodophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| SMILES | CC1CCC(C(C)C)C(NC(C)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C18H28IN/c1-12(2)17-10-5-13(3)11-18(17)20-14(4)15-6-8-16(19)9-7-15/h6-9,12-14,17-18,20H,5,10-11H2,1-4H3 |
| InChIKey | RIIWKLZYYUSCRP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|