C18H28FN — CID 43078452
N-[1-(3-fluorophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine (PubChem CID 43078452) has the molecular formula C18H28FN and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43078452 |
| Molecular Formula | C18H28FN |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| SMILES | CC1CCC(C(C)C)C(NC(C)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C18H28FN/c1-12(2)17-9-8-13(3)10-18(17)20-14(4)15-6-5-7-16(19)11-15/h5-7,11-14,17-18,20H,8-10H2,1-4H3 |
| InChIKey | QMVJCCFOHYDXNE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |