C16H24IN — CID 64742976
3-ethyl-N-[1-(4-iodophenyl)ethyl]cyclohexan-1-amine (PubChem CID 64742976) has the molecular formula C16H24IN and a molecular weight of 357.28 g/mol. Its IUPAC name is 3-ethyl-N-[1-(4-iodophenyl)ethyl]cyclohexan-1-amine.
| Compound Name | 3-ethyl-N-[1-(4-iodophenyl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 64742976 |
| Molecular Formula | C16H24IN |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-ethyl-N-[1-(4-iodophenyl)ethyl]cyclohexan-1-amine |
| SMILES | CCC1CCCC(NC(C)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C16H24IN/c1-3-13-5-4-6-16(11-13)18-12(2)14-7-9-15(17)10-8-14/h7-10,12-13,16,18H,3-6,11H2,1-2H3 |
| InChIKey | INKIELVVXIONGX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|