C16H25N — CID 81349259
3-ethyl-N-[(1R)-1-(4-methylphenyl)ethyl]cyclopentan-1-amine (PubChem CID 81349259) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-ethyl-N-[(1R)-1-(4-methylphenyl)ethyl]cyclopentan-1-amine.
| Compound Name | 3-ethyl-N-[(1R)-1-(4-methylphenyl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 81349259 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-ethyl-N-[(1R)-1-(4-methylphenyl)ethyl]cyclopentan-1-amine |
| SMILES | CCC1CCC(N[C@H](C)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C16H25N/c1-4-14-7-10-16(11-14)17-13(3)15-8-5-12(2)6-9-15/h5-6,8-9,13-14,16-17H,4,7,10-11H2,1-3H3/t13-,14?,16?/m1/s1 |
| InChIKey | YHTRTXTUQWDULN-VQCLRJIVSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |