C13H20N2 — CID 81349548
1-N-[(1R)-1-(4-methylphenyl)ethyl]cyclobutane-1,3-diamine (PubChem CID 81349548) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-N-[(1R)-1-(4-methylphenyl)ethyl]cyclobutane-1,3-diamine.
| Compound Name | 1-N-[(1R)-1-(4-methylphenyl)ethyl]cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 81349548 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-N-[(1R)-1-(4-methylphenyl)ethyl]cyclobutane-1,3-diamine |
| SMILES | Cc1ccc([C@@H](C)NC2CC(N)C2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-9-3-5-11(6-4-9)10(2)15-13-7-12(14)8-13/h3-6,10,12-13,15H,7-8,14H2,1-2H3/t10-,12?,13?/m1/s1 |
| InChIKey | KHYIBCMKLMVORW-QFWMXSHPSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |