C15H24N2O2 — CID 43373375
2-methoxy-4-[1-[(1-methylpiperidin-4-yl)amino]ethyl]phenol (PubChem CID 43373375) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-methoxy-4-[1-[(1-methylpiperidin-4-yl)amino]ethyl]phenol.
| Compound Name | 2-methoxy-4-[1-[(1-methylpiperidin-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 43373375 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-methoxy-4-[1-[(1-methylpiperidin-4-yl)amino]ethyl]phenol |
| SMILES | COc1cc(C(C)NC2CCN(C)CC2)ccc1O |
| InChI | InChI=1S/C15H24N2O2/c1-11(16-13-6-8-17(2)9-7-13)12-4-5-14(18)15(10-12)19-3/h4-5,10-11,13,16,18H,6-9H2,1-3H3 |
| InChIKey | TYTHFEHBMGTIDR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |