C16H23N3 — CID 81342944
3-[1-[(1,2-dimethylpiperidin-4-yl)amino]ethyl]benzonitrile (PubChem CID 81342944) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-[1-[(1,2-dimethylpiperidin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 3-[1-[(1,2-dimethylpiperidin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 81342944 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3-[1-[(1,2-dimethylpiperidin-4-yl)amino]ethyl]benzonitrile |
| SMILES | CC(NC1CCN(C)C(C)C1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H23N3/c1-12-9-16(7-8-19(12)3)18-13(2)15-6-4-5-14(10-15)11-17/h4-6,10,12-13,16,18H,7-9H2,1-3H3 |
| InChIKey | HSKJBVDDCRXJIV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |