C26H31N3 — CID 22675832
1-(2-adamantyl)-3-(9H-fluoren-1-yl)-1,3-dimethylguanidine (PubChem CID 22675832) has the molecular formula C26H31N3 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(9H-fluoren-1-yl)-1,3-dimethylguanidine.
| Compound Name | 1-(2-adamantyl)-3-(9H-fluoren-1-yl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 22675832 |
| Molecular Formula | C26H31N3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-(2-adamantyl)-3-(9H-fluoren-1-yl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc2c1Cc1ccccc1-2)N(C)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C26H31N3/c1-28(24-9-5-8-22-21-7-4-3-6-18(21)15-23(22)24)26(27)29(2)25-19-11-16-10-17(13-19)14-20(25)12-16/h3-9,16-17,19-20,25,27H,10-15H2,1-2H3/b27-26+ |
| InChIKey | UDTPAUBSSGDNTL-CYYJNZCTSA-N |
| XLogP | 5.39 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|