C20H29NO3 — CID 22681056
2-[3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propoxy]benzoic acid (PubChem CID 22681056) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propoxy]benzoic acid.
| Compound Name | 2-[3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propoxy]benzoic acid |
|---|---|
| PubChem CID | 22681056 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-[3-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)propoxy]benzoic acid |
| SMILES | CC1(C)CC2CC(C)(CN2CCCOc2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C20H29NO3/c1-19(2)11-15-12-20(3,13-19)14-21(15)9-6-10-24-17-8-5-4-7-16(17)18(22)23/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,22,23) |
| InChIKey | ACFIKLXRRUWMNB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|