C17H17BrO4 — CID 22681269
3-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]benzoic acid (PubChem CID 22681269) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 3-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]benzoic acid.
| Compound Name | 3-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 22681269 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 3-[2-(2-bromo-4,6-dimethylphenoxy)ethoxy]benzoic acid |
| SMILES | Cc1cc(C)c(OCCOc2cccc(C(=O)O)c2)c(Br)c1 |
| InChI | InChI=1S/C17H17BrO4/c1-11-8-12(2)16(15(18)9-11)22-7-6-21-14-5-3-4-13(10-14)17(19)20/h3-5,8-10H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | BIPIRBMZQWQFGA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|