C22H26N2O3 — CID 22681411
2-cyano-N-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methyl]acetamide (PubChem CID 22681411) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-cyano-N-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 22681411 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-cyano-N-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]phenyl]methyl]acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCCOc2ccccc2CNC(=O)CC#N)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-16(2)19-9-8-17(3)14-21(19)27-13-12-26-20-7-5-4-6-18(20)15-24-22(25)10-11-23/h4-9,14,16H,10,12-13,15H2,1-3H3,(H,24,25) |
| InChIKey | JNUPHURWNZDSRG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|