C18H19BrO5 — CID 22687384
5-bromo-2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxybenzoic acid (PubChem CID 22687384) has the molecular formula C18H19BrO5 and a molecular weight of 395.25 g/mol. Its IUPAC name is 5-bromo-2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxybenzoic acid.
| Compound Name | 5-bromo-2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 22687384 |
| Molecular Formula | C18H19BrO5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 5-bromo-2-[2-(3,5-dimethylphenoxy)ethoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(Br)cc(C(=O)O)c1OCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H19BrO5/c1-11-6-12(2)8-14(7-11)23-4-5-24-17-15(18(20)21)9-13(19)10-16(17)22-3/h6-10H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | BJIOXTRZTIWOPE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|