C13H11ClO3S — CID 22687747
4-[(2-chlorophenyl)sulfanylmethyl]-5-methylfuran-2-carboxylic acid (PubChem CID 22687747) has the molecular formula C13H11ClO3S and a molecular weight of 282.75 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)sulfanylmethyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2-chlorophenyl)sulfanylmethyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 22687747 |
| Molecular Formula | C13H11ClO3S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 4-[(2-chlorophenyl)sulfanylmethyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CSc1ccccc1Cl |
| InChI | InChI=1S/C13H11ClO3S/c1-8-9(6-11(17-8)13(15)16)7-18-12-5-3-2-4-10(12)14/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | NHHSEMIORKEUBS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |