C24H30ClN3O3 — CID 22693863
N-(4-ethylphenyl)-2-(4-methoxyanilino)acetamide;4-methoxyaniline;hydrochloride (PubChem CID 22693863) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(4-methoxyanilino)acetamide;4-methoxyaniline;hydrochloride.
| Compound Name | N-(4-ethylphenyl)-2-(4-methoxyanilino)acetamide;4-methoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 22693863 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-(4-ethylphenyl)-2-(4-methoxyanilino)acetamide;4-methoxyaniline;hydrochloride |
| SMILES | CCc1ccc(NC(=O)CNc2ccc(OC)cc2)cc1.COc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C17H20N2O2.C7H9NO.ClH/c1-3-13-4-6-15(7-5-13)19-17(20)12-18-14-8-10-16(21-2)11-9-14;1-9-7-4-2-6(8)3-5-7;/h4-11,18H,3,12H2,1-2H3,(H,19,20);2-5H,8H2,1H3;1H |
| InChIKey | FKYLMMOVOIUYCG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|