C18H15ClN2O5S — CID 22696558
2-chloro-5-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]oxysulfonylbenzoic acid (PubChem CID 22696558) has the molecular formula C18H15ClN2O5S and a molecular weight of 406.85 g/mol. Its IUPAC name is 2-chloro-5-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]oxysulfonylbenzoic acid.
| Compound Name | 2-chloro-5-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]oxysulfonylbenzoic acid |
|---|---|
| PubChem CID | 22696558 |
| Molecular Formula | C18H15ClN2O5S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-chloro-5-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]oxysulfonylbenzoic acid |
| SMILES | Cc1ccc(-n2nc(C)cc2OS(=O)(=O)c2ccc(Cl)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H15ClN2O5S/c1-11-3-5-13(6-4-11)21-17(9-12(2)20-21)26-27(24,25)14-7-8-16(19)15(10-14)18(22)23/h3-10H,1-2H3,(H,22,23) |
| InChIKey | GOVWIQLEPGQXJL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|