C18H29N5O11 — CID 22699098
2-[[5-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 22699098) has the molecular formula C18H29N5O11 and a molecular weight of 491.45 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[5-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22699098 |
| Molecular Formula | C18H29N5O11 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[[5-amino-2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H29N5O11/c1-7(24)14(23-15(30)8(19)2-5-12(26)27)17(32)21-9(3-4-11(20)25)16(31)22-10(18(33)34)6-13(28)29/h7-10,14,24H,2-6,19H2,1H3,(H2,20,25)(H,21,32)(H,22,31)(H,23,30)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | ISZWDASYVTTYOM-UHFFFAOYSA-N |
| XLogP | -4.16 |
| TPSA | 288.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |