C19H36N8O6S — CID 22703267
2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 22703267) has the molecular formula C19H36N8O6S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22703267 |
| Molecular Formula | C19H36N8O6S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2-[[2-[[4-amino-2-[(2-amino-4-methylpentanoyl)amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C19H36N8O6S/c1-9(2)6-10(20)15(29)26-12(7-14(21)28)17(31)25-11(4-3-5-24-19(22)23)16(30)27-13(8-34)18(32)33/h9-13,34H,3-8,20H2,1-2H3,(H2,21,28)(H,25,31)(H,26,29)(H,27,30)(H,32,33)(H4,22,23,24) |
| InChIKey | KZSABSTXKYJODB-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|