C19H19N3O2S3 — CID 2270662
N-(4-methyl-1,3-thiazol-2-yl)-2-[(5E)-4-oxo-5-[(4-propan-2-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 2270662) has the molecular formula C19H19N3O2S3 and a molecular weight of 417.58 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-[(5E)-4-oxo-5-[(4-propan-2-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-[(5E)-4-oxo-5-[(4-propan-2-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2270662 |
| Molecular Formula | C19H19N3O2S3 |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-[(5E)-4-oxo-5-[(4-propan-2-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1csc(NC(=O)CN2C(=O)/C(=C\c3ccc(C(C)C)cc3)SC2=S)n1 |
| InChI | InChI=1S/C19H19N3O2S3/c1-11(2)14-6-4-13(5-7-14)8-15-17(24)22(19(25)27-15)9-16(23)21-18-20-12(3)10-26-18/h4-8,10-11H,9H2,1-3H3,(H,20,21,23)/b15-8+ |
| InChIKey | DRTAIJGTKDJXQP-OVCLIPMQSA-N |
| XLogP | 4.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|