C27H36FNO4S — CID 22707921
1-[4-[3-[2-(benzenesulfonyl)-2-fluoro-1-hydroxyethyl]phenyl]-3,4-dimethylpiperidin-1-yl]hexan-1-one (PubChem CID 22707921) has the molecular formula C27H36FNO4S and a molecular weight of 489.65 g/mol. Its IUPAC name is 1-[4-[3-[2-(benzenesulfonyl)-2-fluoro-1-hydroxyethyl]phenyl]-3,4-dimethylpiperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[3-[2-(benzenesulfonyl)-2-fluoro-1-hydroxyethyl]phenyl]-3,4-dimethylpiperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 22707921 |
| Molecular Formula | C27H36FNO4S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-[4-[3-[2-(benzenesulfonyl)-2-fluoro-1-hydroxyethyl]phenyl]-3,4-dimethylpiperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(C)(c2cccc(C(O)C(F)S(=O)(=O)c3ccccc3)c2)C(C)C1 |
| InChI | InChI=1S/C27H36FNO4S/c1-4-5-7-15-24(30)29-17-16-27(3,20(2)19-29)22-12-10-11-21(18-22)25(31)26(28)34(32,33)23-13-8-6-9-14-23/h6,8-14,18,20,25-26,31H,4-5,7,15-17,19H2,1-3H3 |
| InChIKey | GKVZQZYYKLOVPR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|