C22H22FN2O7- — CID 2270822
(2S)-2-[[(Z)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]propanoate (PubChem CID 2270822) has the molecular formula C22H22FN2O7- and a molecular weight of 445.42 g/mol. Its IUPAC name is (2S)-2-[[(Z)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]propanoate.
| Compound Name | (2S)-2-[[(Z)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 2270822 |
| Molecular Formula | C22H22FN2O7- |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2S)-2-[[(Z)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]propanoate |
| SMILES | COc1cc(C(=O)N/C(=C\c2ccc(F)cc2)C(=O)N[C@@H](C)C(=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C22H23FN2O7/c1-12(22(28)29)24-21(27)16(9-13-5-7-15(23)8-6-13)25-20(26)14-10-17(30-2)19(32-4)18(11-14)31-3/h5-12H,1-4H3,(H,24,27)(H,25,26)(H,28,29)/p-1/b16-9-/t12-/m0/s1 |
| InChIKey | OMRSNRTZMWHYCR-PFSWGADMSA-M |
| XLogP | 0.88 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|