C21H23ClN6O4S2 — CID 22709836
4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide (PubChem CID 22709836) has the molecular formula C21H23ClN6O4S2 and a molecular weight of 523.04 g/mol. Its IUPAC name is 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide.
| Compound Name | 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22709836 |
| Molecular Formula | C21H23ClN6O4S2 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(S(=O)(=O)c2cc3cc(Cl)ccc3[nH]2)CCN1C(=O)c1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C21H23ClN6O4S2/c1-23-19(29)16-11-27(34(31,32)18-9-12-8-13(22)2-3-14(12)25-18)6-7-28(16)21(30)20-26-15-4-5-24-10-17(15)33-20/h2-3,8-9,16,24-25H,4-7,10-11H2,1H3,(H,23,29) |
| InChIKey | HWBMCBHWYCAJKR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |