C22H25ClN6O7S2 — CID 22709680
4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(6-methylsulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide (PubChem CID 22709680) has the molecular formula C22H25ClN6O7S2 and a molecular weight of 585.06 g/mol. Its IUPAC name is 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(6-methylsulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide.
| Compound Name | 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(6-methylsulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22709680 |
| Molecular Formula | C22H25ClN6O7S2 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 4-[(5-chloro-1H-indol-2-yl)sulfonyl]-N-methyl-1-(6-methylsulfonyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(S(=O)(=O)c2cc3cc(Cl)ccc3[nH]2)CCN1C(=O)c1nc2c(o1)CNC(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C22H25ClN6O7S2/c1-24-20(30)16-11-28(38(34,35)19-8-12-7-13(23)3-4-14(12)26-19)5-6-29(16)22(31)21-27-15-9-18(37(2,32)33)25-10-17(15)36-21/h3-4,7-8,16,18,25-26H,5-6,9-11H2,1-2H3,(H,24,30) |
| InChIKey | CTYXXMXZLWMPHG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 174.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |