C22H26ClN5O4S — CID 22710399
[4-[(5-chloro-1H-indol-2-yl)sulfonyl]-2-ethylpiperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)methanone (PubChem CID 22710399) has the molecular formula C22H26ClN5O4S and a molecular weight of 492.00 g/mol. Its IUPAC name is [4-[(5-chloro-1H-indol-2-yl)sulfonyl]-2-ethylpiperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)methanone.
| Compound Name | [4-[(5-chloro-1H-indol-2-yl)sulfonyl]-2-ethylpiperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 22710399 |
| Molecular Formula | C22H26ClN5O4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [4-[(5-chloro-1H-indol-2-yl)sulfonyl]-2-ethylpiperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)methanone |
| SMILES | CCC1CN(S(=O)(=O)c2cc3cc(Cl)ccc3[nH]2)CCN1C(=O)c1nc2c(o1)CNC(C)C2 |
| InChI | InChI=1S/C22H26ClN5O4S/c1-3-16-12-27(33(30,31)20-10-14-9-15(23)4-5-17(14)25-20)6-7-28(16)22(29)21-26-18-8-13(2)24-11-19(18)32-21/h4-5,9-10,13,16,24-25H,3,6-8,11-12H2,1-2H3 |
| InChIKey | MPHPQARUBXSEFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |