C23H20N4O3 — CID 22713596
4-[5-methyl-2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylic acid (PubChem CID 22713596) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[5-methyl-2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[5-methyl-2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 22713596 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[5-methyl-2-(3-phenylmethoxyanilino)pyrimidin-4-yl]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cnc(Nc2cccc(OCc3ccccc3)c2)nc1-c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-15-12-25-23(27-21(15)17-10-20(22(28)29)24-13-17)26-18-8-5-9-19(11-18)30-14-16-6-3-2-4-7-16/h2-13,24H,14H2,1H3,(H,28,29)(H,25,26,27) |
| InChIKey | UBNDDTAOXOAXBY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |