C15H14ClNO3 — CID 22715091
4-chloro-2-[1-(furan-3-yl)-4-hydroxybutoxy]benzonitrile (PubChem CID 22715091) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 4-chloro-2-[1-(furan-3-yl)-4-hydroxybutoxy]benzonitrile.
| Compound Name | 4-chloro-2-[1-(furan-3-yl)-4-hydroxybutoxy]benzonitrile |
|---|---|
| PubChem CID | 22715091 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-chloro-2-[1-(furan-3-yl)-4-hydroxybutoxy]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1OC(CCCO)c1ccoc1 |
| InChI | InChI=1S/C15H14ClNO3/c16-13-4-3-11(9-17)15(8-13)20-14(2-1-6-18)12-5-7-19-10-12/h3-5,7-8,10,14,18H,1-2,6H2 |
| InChIKey | LEWHNTZNVNZPIH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |