C16H14ClIN2O — CID 22715185
4-chloro-2-(4-iodo-1-pyridin-2-ylbutoxy)benzonitrile (PubChem CID 22715185) has the molecular formula C16H14ClIN2O and a molecular weight of 412.66 g/mol. Its IUPAC name is 4-chloro-2-(4-iodo-1-pyridin-2-ylbutoxy)benzonitrile.
| Compound Name | 4-chloro-2-(4-iodo-1-pyridin-2-ylbutoxy)benzonitrile |
|---|---|
| PubChem CID | 22715185 |
| Molecular Formula | C16H14ClIN2O |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | 4-chloro-2-(4-iodo-1-pyridin-2-ylbutoxy)benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1OC(CCCI)c1ccccn1 |
| InChI | InChI=1S/C16H14ClIN2O/c17-13-7-6-12(11-19)16(10-13)21-15(5-3-8-18)14-4-1-2-9-20-14/h1-2,4,6-7,9-10,15H,3,5,8H2 |
| InChIKey | RNVVOEQWMBKPPL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|