C14H23F3O2Si — CID 22717499
dimethyl-[4-(oxan-2-yloxy)but-1-ynyl]-(3,3,3-trifluoropropyl)silane (PubChem CID 22717499) has the molecular formula C14H23F3O2Si and a molecular weight of 308.42 g/mol. Its IUPAC name is dimethyl-[4-(oxan-2-yloxy)but-1-ynyl]-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl-[4-(oxan-2-yloxy)but-1-ynyl]-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 22717499 |
| Molecular Formula | C14H23F3O2Si |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | dimethyl-[4-(oxan-2-yloxy)but-1-ynyl]-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(C#CCCOC1CCCCO1)CCC(F)(F)F |
| InChI | InChI=1S/C14H23F3O2Si/c1-20(2,12-8-14(15,16)17)11-6-5-10-19-13-7-3-4-9-18-13/h13H,3-5,7-10,12H2,1-2H3 |
| InChIKey | CFVOYNRKVBQUCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|