C13H21F3O2Si — CID 22717494
dimethyl-[3-(oxan-2-yloxy)prop-1-ynyl]-(3,3,3-trifluoropropyl)silane (PubChem CID 22717494) has the molecular formula C13H21F3O2Si and a molecular weight of 294.39 g/mol. Its IUPAC name is dimethyl-[3-(oxan-2-yloxy)prop-1-ynyl]-(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl-[3-(oxan-2-yloxy)prop-1-ynyl]-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 22717494 |
| Molecular Formula | C13H21F3O2Si |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | dimethyl-[3-(oxan-2-yloxy)prop-1-ynyl]-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(C#CCOC1CCCCO1)CCC(F)(F)F |
| InChI | InChI=1S/C13H21F3O2Si/c1-19(2,11-7-13(14,15)16)10-5-9-18-12-6-3-4-8-17-12/h12H,3-4,6-9,11H2,1-2H3 |
| InChIKey | JCQKKABGPPNCJZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|