About 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride
2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (PubChem CID 22719621) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
Analyze 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The IUPAC name of 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CID 22719621) is 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The canonical SMILES for 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is Cl.NC1Cc2ccc(C(=O)O)cc2C1.
What is the InChIKey of 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
The InChIKey is IZPMCQYSYQAJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.ClH/c11-9-4-6-1-2-7(10(12)13)3-8(6)5-9;/h1-3,9H,4-5,11H2,(H,12,13);1H.
What are the key properties of 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride?
2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 22719621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).