C15H25Cl3N4O — CID 22721820
piperazin-1-yl-(1-pyridin-4-ylpiperidin-4-yl)methanone;trihydrochloride (PubChem CID 22721820) has the molecular formula C15H25Cl3N4O and a molecular weight of 383.75 g/mol. Its IUPAC name is piperazin-1-yl-(1-pyridin-4-ylpiperidin-4-yl)methanone;trihydrochloride.
| Compound Name | piperazin-1-yl-(1-pyridin-4-ylpiperidin-4-yl)methanone;trihydrochloride |
|---|---|
| PubChem CID | 22721820 |
| Molecular Formula | C15H25Cl3N4O |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | piperazin-1-yl-(1-pyridin-4-ylpiperidin-4-yl)methanone;trihydrochloride |
| SMILES | Cl.Cl.Cl.O=C(C1CCN(c2ccncc2)CC1)N1CCNCC1 |
| InChI | InChI=1S/C15H22N4O.3ClH/c20-15(19-11-7-17-8-12-19)13-3-9-18(10-4-13)14-1-5-16-6-2-14;;;/h1-2,5-6,13,17H,3-4,7-12H2;3*1H |
| InChIKey | IQWBXSUUWQJNFK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |