C13H24N4O3S — CID 22723277
S-[2-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamoylamino]ethyl] ethanethioate (PubChem CID 22723277) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is S-[2-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamoylamino]ethyl] ethanethioate.
| Compound Name | S-[2-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamoylamino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 22723277 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | S-[2-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-yl]carbamoylamino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCNC(=O)NC(C)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H24N4O3S/c1-10(12(19)17-7-5-16(3)6-8-17)15-13(20)14-4-9-21-11(2)18/h10H,4-9H2,1-3H3,(H2,14,15,20) |
| InChIKey | OELZUQNAVQPPGS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|