C12H24N2O2S — CID 11207696
2-acetamido-N,N-diethyl-3-propan-2-ylsulfanylpropanamide (PubChem CID 11207696) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-acetamido-N,N-diethyl-3-propan-2-ylsulfanylpropanamide.
| Compound Name | 2-acetamido-N,N-diethyl-3-propan-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 11207696 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-acetamido-N,N-diethyl-3-propan-2-ylsulfanylpropanamide |
| SMILES | CCN(CC)C(=O)C(CSC(C)C)NC(C)=O |
| InChI | InChI=1S/C12H24N2O2S/c1-6-14(7-2)12(16)11(13-10(5)15)8-17-9(3)4/h9,11H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | RYDVPKCXGXTLCY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |