C13H22N2O4S2 — CID 516561
S-[2-[[(2R)-2-acetamido-3-acetylsulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate (PubChem CID 516561) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is S-[2-[[(2R)-2-acetamido-3-acetylsulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate.
| Compound Name | S-[2-[[(2R)-2-acetamido-3-acetylsulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 516561 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | S-[2-[[(2R)-2-acetamido-3-acetylsulfanylpropanoyl]amino]ethyl] 2-methylpropanethioate |
| SMILES | CC(=O)N[C@@H](CSC(C)=O)C(=O)NCCSC(=O)C(C)C |
| InChI | InChI=1S/C13H22N2O4S2/c1-8(2)13(19)20-6-5-14-12(18)11(15-9(3)16)7-21-10(4)17/h8,11H,5-7H2,1-4H3,(H,14,18)(H,15,16)/t11-/m0/s1 |
| InChIKey | NYJXJFZWNPKMBX-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|