C25H31N3O6 — CID 22725270
3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-1-methyl-2,3-dihydroindole;oxalic acid (PubChem CID 22725270) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-1-methyl-2,3-dihydroindole;oxalic acid.
| Compound Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-1-methyl-2,3-dihydroindole;oxalic acid |
|---|---|
| PubChem CID | 22725270 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 3-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-1-methyl-2,3-dihydroindole;oxalic acid |
| SMILES | CN1CC(CCN2CCN(c3cccc4c3OCCO4)CC2)c2ccccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H29N3O2.C2H2O4/c1-24-17-18(19-5-2-3-6-20(19)24)9-10-25-11-13-26(14-12-25)21-7-4-8-22-23(21)28-16-15-27-22;3-1(4)2(5)6/h2-8,18H,9-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OMVOWFZPSBGZGU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|