C17H30N4O5 — CID 22726580
tert-butyl (NZ)-N-[(4-carbamoylpiperidin-1-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 22726580) has the molecular formula C17H30N4O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(4-carbamoylpiperidin-1-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(4-carbamoylpiperidin-1-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 22726580 |
| Molecular Formula | C17H30N4O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | tert-butyl (NZ)-N-[(4-carbamoylpiperidin-1-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H30N4O5/c1-16(2,3)25-14(23)19-13(20-15(24)26-17(4,5)6)21-9-7-11(8-10-21)12(18)22/h11H,7-10H2,1-6H3,(H2,18,22)(H,19,20,23,24) |
| InChIKey | UEFNPJPGXPIAEE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|