C16H15ClN3O5S- — CID 22727188
2-[[4-(6-chloronaphthalen-2-yl)sulfonyl-2-oxopiperazin-1-yl]amino]acetate (PubChem CID 22727188) has the molecular formula C16H15ClN3O5S- and a molecular weight of 396.83 g/mol. Its IUPAC name is 2-[[4-(6-chloronaphthalen-2-yl)sulfonyl-2-oxopiperazin-1-yl]amino]acetate.
| Compound Name | 2-[[4-(6-chloronaphthalen-2-yl)sulfonyl-2-oxopiperazin-1-yl]amino]acetate |
|---|---|
| PubChem CID | 22727188 |
| Molecular Formula | C16H15ClN3O5S- |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[[4-(6-chloronaphthalen-2-yl)sulfonyl-2-oxopiperazin-1-yl]amino]acetate |
| SMILES | O=C([O-])CNN1CCN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CC1=O |
| InChI | InChI=1S/C16H16ClN3O5S/c17-13-3-1-12-8-14(4-2-11(12)7-13)26(24,25)19-5-6-20(15(21)10-19)18-9-16(22)23/h1-4,7-8,18H,5-6,9-10H2,(H,22,23)/p-1 |
| InChIKey | FGILTTUIDYIGKU-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |