C21H15F3NO3S- — CID 22728025
(E)-3-[4-[[4-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]prop-2-enoate (PubChem CID 22728025) has the molecular formula C21H15F3NO3S- and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-3-[4-[[4-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]prop-2-enoate.
| Compound Name | (E)-3-[4-[[4-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 22728025 |
| Molecular Formula | C21H15F3NO3S- |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (E)-3-[4-[[4-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)sc1COc1ccc(/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C21H16F3NO3S/c1-13-18(12-28-17-8-5-14(6-9-17)7-10-19(26)27)29-20(25-13)15-3-2-4-16(11-15)21(22,23)24/h2-11H,12H2,1H3,(H,26,27)/p-1/b10-7+ |
| InChIKey | AWASAGXKQONBNC-JXMROGBWSA-M |
| XLogP | 4.48 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|