C25H32N2O2 — CID 22729907
N,N-diethyl-4-[4-(3-hydroxyphenyl)-1-prop-2-enylpiperidin-4-yl]benzamide (PubChem CID 22729907) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(3-hydroxyphenyl)-1-prop-2-enylpiperidin-4-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-(3-hydroxyphenyl)-1-prop-2-enylpiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22729907 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N,N-diethyl-4-[4-(3-hydroxyphenyl)-1-prop-2-enylpiperidin-4-yl]benzamide |
| SMILES | C=CCN1CCC(c2ccc(C(=O)N(CC)CC)cc2)(c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-4-16-26-17-14-25(15-18-26,22-8-7-9-23(28)19-22)21-12-10-20(11-13-21)24(29)27(5-2)6-3/h4,7-13,19,28H,1,5-6,14-18H2,2-3H3 |
| InChIKey | GHGXXGRQBXBJPK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|