C22H30N2O3 — CID 22730529
methyl 4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-2-methoxyphenyl]benzoate (PubChem CID 22730529) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl 4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-2-methoxyphenyl]benzoate.
| Compound Name | methyl 4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-2-methoxyphenyl]benzoate |
|---|---|
| PubChem CID | 22730529 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | methyl 4-[4-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-2-methoxyphenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(CCN(C)CCN(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-23(2)14-15-24(3)13-12-17-6-11-20(21(16-17)26-4)18-7-9-19(10-8-18)22(25)27-5/h6-11,16H,12-15H2,1-5H3 |
| InChIKey | PGZACAZVGFLKNQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |