C24H25BrN2O3S — CID 22732588
2-[[2-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-sulfanylpropanoyl]amino]-3-(5-methyl-1H-indol-3-yl)propanoic acid (PubChem CID 22732588) has the molecular formula C24H25BrN2O3S and a molecular weight of 501.45 g/mol. Its IUPAC name is 2-[[2-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-sulfanylpropanoyl]amino]-3-(5-methyl-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-sulfanylpropanoyl]amino]-3-(5-methyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22732588 |
| Molecular Formula | C24H25BrN2O3S |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2-[[2-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-sulfanylpropanoyl]amino]-3-(5-methyl-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1ccc2[nH]cc(CC(NC(=O)C(CS)C3CCc4cc(Br)ccc43)C(=O)O)c2c1 |
| InChI | InChI=1S/C24H25BrN2O3S/c1-13-2-7-21-19(8-13)15(11-26-21)10-22(24(29)30)27-23(28)20(12-31)18-5-3-14-9-16(25)4-6-17(14)18/h2,4,6-9,11,18,20,22,26,31H,3,5,10,12H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | QSTHJMYEUZAPAM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|