C13H15BN2O3 — CID 54078540
3-(5-methyl-1H-indol-3-yl)-2-(oxoboranylmethylamino)propanoic acid (PubChem CID 54078540) has the molecular formula C13H15BN2O3 and a molecular weight of 258.09 g/mol. Its IUPAC name is 3-(5-methyl-1H-indol-3-yl)-2-(oxoboranylmethylamino)propanoic acid.
| Compound Name | 3-(5-methyl-1H-indol-3-yl)-2-(oxoboranylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 54078540 |
| Molecular Formula | C13H15BN2O3 |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-(5-methyl-1H-indol-3-yl)-2-(oxoboranylmethylamino)propanoic acid |
| SMILES | Cc1ccc2[nH]cc(CC(NCB=O)C(=O)O)c2c1 |
| InChI | InChI=1S/C13H15BN2O3/c1-8-2-3-11-10(4-8)9(6-15-11)5-12(13(17)18)16-7-14-19/h2-4,6,12,15-16H,5,7H2,1H3,(H,17,18) |
| InChIKey | ACIOPVOKWKJDGB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|