C27H30N2O5S — CID 22732592
methyl 2-[[3-acetylsulfanyl-2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 22732592) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is methyl 2-[[3-acetylsulfanyl-2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[3-acetylsulfanyl-2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 22732592 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | methyl 2-[[3-acetylsulfanyl-2-(5-methoxy-2,3-dihydro-1H-inden-1-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CSC(C)=O)C1CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C27H30N2O5S/c1-16(30)35-15-23(22-10-8-17-12-19(33-2)9-11-20(17)22)26(31)29-25(27(32)34-3)13-18-14-28-24-7-5-4-6-21(18)24/h4-7,9,11-12,14,22-23,25,28H,8,10,13,15H2,1-3H3,(H,29,31) |
| InChIKey | YOCSDWQQIHIOES-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|