C23H18N2O4 — CID 22733923
7-methoxy-N-phenyl-4-(2-pyridin-4-ylacetyl)-1-benzofuran-2-carboxamide (PubChem CID 22733923) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 7-methoxy-N-phenyl-4-(2-pyridin-4-ylacetyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-phenyl-4-(2-pyridin-4-ylacetyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 22733923 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 7-methoxy-N-phenyl-4-(2-pyridin-4-ylacetyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(C(=O)Cc2ccncc2)c2cc(C(=O)Nc3ccccc3)oc12 |
| InChI | InChI=1S/C23H18N2O4/c1-28-20-8-7-17(19(26)13-15-9-11-24-12-10-15)18-14-21(29-22(18)20)23(27)25-16-5-3-2-4-6-16/h2-12,14H,13H2,1H3,(H,25,27) |
| InChIKey | BSMDOTRURYGXAQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |