C27H28N2O3 — CID 22740022
methyl 9-[(2-cyanophenyl)methyl]-5-oxo-7-pentyl-7,8-dihydro-6H-carbazole-4-carboxylate (PubChem CID 22740022) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 9-[(2-cyanophenyl)methyl]-5-oxo-7-pentyl-7,8-dihydro-6H-carbazole-4-carboxylate.
| Compound Name | methyl 9-[(2-cyanophenyl)methyl]-5-oxo-7-pentyl-7,8-dihydro-6H-carbazole-4-carboxylate |
|---|---|
| PubChem CID | 22740022 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | methyl 9-[(2-cyanophenyl)methyl]-5-oxo-7-pentyl-7,8-dihydro-6H-carbazole-4-carboxylate |
| SMILES | CCCCCC1CC(=O)c2c(n(Cc3ccccc3C#N)c3cccc(C(=O)OC)c23)C1 |
| InChI | InChI=1S/C27H28N2O3/c1-3-4-5-9-18-14-23-26(24(30)15-18)25-21(27(31)32-2)12-8-13-22(25)29(23)17-20-11-7-6-10-19(20)16-28/h6-8,10-13,18H,3-5,9,14-15,17H2,1-2H3 |
| InChIKey | NJMWQQFNQLDAJL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|