C28H21N3O8S — CID 2274143
methyl (2E,5R)-5-(4-acetyloxyphenyl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 2274143) has the molecular formula C28H21N3O8S and a molecular weight of 559.56 g/mol. Its IUPAC name is methyl (2E,5R)-5-(4-acetyloxyphenyl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | methyl (2E,5R)-5-(4-acetyloxyphenyl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2274143 |
| Molecular Formula | C28H21N3O8S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | methyl (2E,5R)-5-(4-acetyloxyphenyl)-7-methyl-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N=c2s/c(=C/c3ccc(-c4cccc([N+](=O)[O-])c4)o3)c(=O)n2[C@@H]1c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C28H21N3O8S/c1-15-24(27(34)37-3)25(17-7-9-20(10-8-17)38-16(2)32)30-26(33)23(40-28(30)29-15)14-21-11-12-22(39-21)18-5-4-6-19(13-18)31(35)36/h4-14,25H,1-3H3/b23-14+/t25-/m1/s1 |
| InChIKey | CPQKIQGADWPQIP-AQIZGWBQSA-N |
| XLogP | 3.50 |
| TPSA | 143.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|